C20H23F3N4O3 — CID 167720016
3-[4-[[5-amino-2-(trifluoromethyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167720016) has the molecular formula C20H23F3N4O3 and a molecular weight of 424.42 g/mol. Its IUPAC name is 3-[4-[[5-amino-2-(trifluoromethyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[[5-amino-2-(trifluoromethyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167720016 |
| Molecular Formula | C20H23F3N4O3 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 3-[4-[[5-amino-2-(trifluoromethyl)piperidin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | NC1CCC(C(F)(F)F)N(Cc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3)C1 |
| InChI | InChI=1S/C20H23F3N4O3/c21-20(22,23)15-6-4-13(24)10-26(15)8-11-2-1-3-12-9-27(19(30)17(11)12)14-5-7-16(28)25-18(14)29/h1-3,13-15H,4-10,24H2,(H,25,28,29) |
| InChIKey | KEQOHOQTJPFTSM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|