C23H25ClN6O3 — CID 167720041
3-[6-[[(6-chloropyridazin-3-yl)methyl-pyrrolidin-3-ylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167720041) has the molecular formula C23H25ClN6O3 and a molecular weight of 468.95 g/mol. Its IUPAC name is 3-[6-[[(6-chloropyridazin-3-yl)methyl-pyrrolidin-3-ylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(6-chloropyridazin-3-yl)methyl-pyrrolidin-3-ylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167720041 |
| Molecular Formula | C23H25ClN6O3 |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 3-[6-[[(6-chloropyridazin-3-yl)methyl-pyrrolidin-3-ylamino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN(Cc4ccc(Cl)nn4)C4CCNC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H25ClN6O3/c24-20-5-2-16(27-28-20)13-29(17-7-8-25-10-17)11-14-1-3-18-15(9-14)12-30(23(18)33)19-4-6-21(31)26-22(19)32/h1-3,5,9,17,19,25H,4,6-8,10-13H2,(H,26,31,32) |
| InChIKey | DUVFHTBQGDZIPL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|