C21H25N5O5 — CID 167720194
2-(2,6-dioxopiperidin-3-yl)-5-[[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]methyl]isoindole-1,3-dione (PubChem CID 167720194) has the molecular formula C21H25N5O5 and a molecular weight of 427.46 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167720194 |
| Molecular Formula | C21H25N5O5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[[methyl-(2-oxo-2-piperazin-1-ylethyl)amino]methyl]isoindole-1,3-dione |
| SMILES | CN(CC(=O)N1CCNCC1)Cc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C21H25N5O5/c1-24(12-18(28)25-8-6-22-7-9-25)11-13-2-3-14-15(10-13)21(31)26(20(14)30)16-4-5-17(27)23-19(16)29/h2-3,10,16,22H,4-9,11-12H2,1H3,(H,23,27,29) |
| InChIKey | UTIVOGZBLSSAEW-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|