About 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride
6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride (PubChem CID 167720369) has the molecular formula C7H4BrFN2O2S
and a molecular weight of 279.09 g/mol. Its IUPAC name is 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride.
Molecular Properties
| Compound Name | 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride |
| PubChem CID | 167720369 |
| Molecular Formula | C7H4BrFN2O2S |
| Molecular Weight | 279.09 g/mol |
| Exact Mass | 277.92 |
| IUPAC Name | 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride |
| SMILES | O=S(=O)(F)c1cnc2ccc(Br)cn12 |
| InChI | InChI=1S/C7H4BrFN2O2S/c8-5-1-2-6-10-3-7(11(6)4-5)14(9,12)13/h1-4H |
| InChIKey | YYDVKDOJDMYIRE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.09 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride?
The IUPAC name of 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride (CID 167720369) is 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride.
What is the SMILES notation for 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride?
The canonical SMILES for 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride is O=S(=O)(F)c1cnc2ccc(Br)cn12.
What is the InChIKey of 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride?
The InChIKey is YYDVKDOJDMYIRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrFN2O2S/c8-5-1-2-6-10-3-7(11(6)4-5)14(9,12)13/h1-4H.
What are the key properties of 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride?
6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride has a molecular weight of 279.09 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride is sourced from PubChem (CID 167720369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).