6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride

C7H4BrFN2O2S — CID 167720369

IUPAC6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride
SMILESO=S(=O)(F)c1cnc2ccc(Br)cn12
InChIInChI=1S/C7H4BrFN2O2S/c8-5-1-2-6-10-3-7(11(6)4-5)14(9,12)13/h1-4H
InChIKeyYYDVKDOJDMYIRE-UHFFFAOYSA-N
MW279.09 g/mol
LogP1.75
Rot. Bonds1

About 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride

6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride (PubChem CID 167720369) has the molecular formula C7H4BrFN2O2S and a molecular weight of 279.09 g/mol. Its IUPAC name is 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride.

Molecular Properties

Compound Name6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride
PubChem CID167720369
Molecular FormulaC7H4BrFN2O2S
Molecular Weight279.09 g/mol
Exact Mass277.92
IUPAC Name6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride
SMILESO=S(=O)(F)c1cnc2ccc(Br)cn12
InChIInChI=1S/C7H4BrFN2O2S/c8-5-1-2-6-10-3-7(11(6)4-5)14(9,12)13/h1-4H
InChIKeyYYDVKDOJDMYIRE-UHFFFAOYSA-N
XLogP1.75
TPSA51.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.09
LogP ≤ 51.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride?
The IUPAC name of 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride (CID 167720369) is 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride.
What is the SMILES notation for 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride?
The canonical SMILES for 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride is O=S(=O)(F)c1cnc2ccc(Br)cn12.
What is the InChIKey of 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride?
The InChIKey is YYDVKDOJDMYIRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrFN2O2S/c8-5-1-2-6-10-3-7(11(6)4-5)14(9,12)13/h1-4H.
What are the key properties of 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride?
6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride has a molecular weight of 279.09 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromoimidazo[1,2-a]pyridine-3-sulfonyl fluoride is sourced from PubChem (CID 167720369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).