C14H17NO4 — CID 167721005
3-[2-[methyl(prop-2-enoxycarbonyl)amino]ethyl]benzoic acid (PubChem CID 167721005) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 3-[2-[methyl(prop-2-enoxycarbonyl)amino]ethyl]benzoic acid.
| Compound Name | 3-[2-[methyl(prop-2-enoxycarbonyl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 167721005 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 3-[2-[methyl(prop-2-enoxycarbonyl)amino]ethyl]benzoic acid |
| SMILES | C=CCOC(=O)N(C)CCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C14H17NO4/c1-3-9-19-14(18)15(2)8-7-11-5-4-6-12(10-11)13(16)17/h3-6,10H,1,7-9H2,2H3,(H,16,17) |
| InChIKey | PYSWLDDJKDWGFI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|