C23H30N4O3 — CID 167721577
3-[6-[(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-ylmethylamino)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167721577) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-[6-[(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-ylmethylamino)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-ylmethylamino)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167721577 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 3-[6-[(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-ylmethylamino)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CNCC4CNC5CCCCC45)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H30N4O3/c28-21-8-7-20(22(29)26-21)27-13-15-9-14(5-6-18(15)23(27)30)10-24-11-16-12-25-19-4-2-1-3-17(16)19/h5-6,9,16-17,19-20,24-25H,1-4,7-8,10-13H2,(H,26,28,29) |
| InChIKey | GAVDITZDLGMSGM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|