About [1-(2,2-dimethoxyethyl)cyclobutyl]methanamine
[1-(2,2-dimethoxyethyl)cyclobutyl]methanamine (PubChem CID 167722061) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is [1-(2,2-dimethoxyethyl)cyclobutyl]methanamine.
Molecular Properties
| Compound Name | [1-(2,2-dimethoxyethyl)cyclobutyl]methanamine |
| PubChem CID | 167722061 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | [1-(2,2-dimethoxyethyl)cyclobutyl]methanamine |
| SMILES | COC(CC1(CN)CCC1)OC |
| InChI | InChI=1S/C9H19NO2/c1-11-8(12-2)6-9(7-10)4-3-5-9/h8H,3-7,10H2,1-2H3 |
| InChIKey | UCHQLOBABAPRTN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,2-dimethoxyethyl)cyclobutyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2-dimethoxyethyl)cyclobutyl]methanamine?
The IUPAC name of [1-(2,2-dimethoxyethyl)cyclobutyl]methanamine (CID 167722061) is [1-(2,2-dimethoxyethyl)cyclobutyl]methanamine.
What is the SMILES notation for [1-(2,2-dimethoxyethyl)cyclobutyl]methanamine?
The canonical SMILES for [1-(2,2-dimethoxyethyl)cyclobutyl]methanamine is COC(CC1(CN)CCC1)OC.
What is the InChIKey of [1-(2,2-dimethoxyethyl)cyclobutyl]methanamine?
The InChIKey is UCHQLOBABAPRTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-11-8(12-2)6-9(7-10)4-3-5-9/h8H,3-7,10H2,1-2H3.
What are the key properties of [1-(2,2-dimethoxyethyl)cyclobutyl]methanamine?
[1-(2,2-dimethoxyethyl)cyclobutyl]methanamine has a molecular weight of 173.26 g/mol, XLogP of 1.12, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2-dimethoxyethyl)cyclobutyl]methanamine is sourced from PubChem (CID 167722061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).