C10H12F3NO4 — CID 167722156
4-(2,2,2-trifluoroacetyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxylic acid (PubChem CID 167722156) has the molecular formula C10H12F3NO4 and a molecular weight of 267.20 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroacetyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxylic acid.
| Compound Name | 4-(2,2,2-trifluoroacetyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 167722156 |
| Molecular Formula | C10H12F3NO4 |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 4-(2,2,2-trifluoroacetyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxylic acid |
| SMILES | O=C(O)C1CC2OCCC2N(C(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C10H12F3NO4/c11-10(12,13)9(17)14-4-5(8(15)16)3-7-6(14)1-2-18-7/h5-7H,1-4H2,(H,15,16) |
| InChIKey | YGGUVFVNRFPMTB-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |