C26H28N6O4 — CID 167723501
2-(2,6-dioxopiperidin-3-yl)-5-[[4-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)piperidin-1-yl]methyl]isoindole-1,3-dione (PubChem CID 167723501) has the molecular formula C26H28N6O4 and a molecular weight of 488.55 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[[4-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)piperidin-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[[4-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)piperidin-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167723501 |
| Molecular Formula | C26H28N6O4 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[[4-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)piperidin-1-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CN4CCC(c5ncc6c(n5)CCNC6)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H28N6O4/c33-22-4-3-21(24(34)30-22)32-25(35)18-2-1-15(11-19(18)26(32)36)14-31-9-6-16(7-10-31)23-28-13-17-12-27-8-5-20(17)29-23/h1-2,11,13,16,21,27H,3-10,12,14H2,(H,30,33,34) |
| InChIKey | YACRZMNAXOIYTQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|