About (5-fluoro-1,2,3,6-tetrahydropyridin-4-yl)methanol
(5-fluoro-1,2,3,6-tetrahydropyridin-4-yl)methanol (PubChem CID 167723525) has the molecular formula C6H10FNO
and a molecular weight of 131.15 g/mol. Its IUPAC name is (5-fluoro-1,2,3,6-tetrahydropyridin-4-yl)methanol.
Molecular Properties
| Compound Name | (5-fluoro-1,2,3,6-tetrahydropyridin-4-yl)methanol |
| PubChem CID | 167723525 |
| Molecular Formula | C6H10FNO |
| Molecular Weight | 131.15 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | (5-fluoro-1,2,3,6-tetrahydropyridin-4-yl)methanol |
| SMILES | OCC1=C(F)CNCC1 |
| InChI | InChI=1S/C6H10FNO/c7-6-3-8-2-1-5(6)4-9/h8-9H,1-4H2 |
| InChIKey | NSUKWKCUXWYIAM-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.15 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-fluoro-1,2,3,6-tetrahydropyridin-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-1,2,3,6-tetrahydropyridin-4-yl)methanol?
The IUPAC name of (5-fluoro-1,2,3,6-tetrahydropyridin-4-yl)methanol (CID 167723525) is (5-fluoro-1,2,3,6-tetrahydropyridin-4-yl)methanol.
What is the SMILES notation for (5-fluoro-1,2,3,6-tetrahydropyridin-4-yl)methanol?
The canonical SMILES for (5-fluoro-1,2,3,6-tetrahydropyridin-4-yl)methanol is OCC1=C(F)CNCC1.
What is the InChIKey of (5-fluoro-1,2,3,6-tetrahydropyridin-4-yl)methanol?
The InChIKey is NSUKWKCUXWYIAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10FNO/c7-6-3-8-2-1-5(6)4-9/h8-9H,1-4H2.
What are the key properties of (5-fluoro-1,2,3,6-tetrahydropyridin-4-yl)methanol?
(5-fluoro-1,2,3,6-tetrahydropyridin-4-yl)methanol has a molecular weight of 131.15 g/mol, XLogP of 0.20, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-1,2,3,6-tetrahydropyridin-4-yl)methanol is sourced from PubChem (CID 167723525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).