C12H8Cl2N2O2S — CID 16772454
5-chloro-2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4-carboxylic acid (PubChem CID 16772454) has the molecular formula C12H8Cl2N2O2S and a molecular weight of 315.18 g/mol. Its IUPAC name is 5-chloro-2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4-carboxylic acid.
| Compound Name | 5-chloro-2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 16772454 |
| Molecular Formula | C12H8Cl2N2O2S |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | 5-chloro-2-[(4-chlorophenyl)methylsulfanyl]pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1nc(SCc2ccc(Cl)cc2)ncc1Cl |
| InChI | InChI=1S/C12H8Cl2N2O2S/c13-8-3-1-7(2-4-8)6-19-12-15-5-9(14)10(16-12)11(17)18/h1-5H,6H2,(H,17,18) |
| InChIKey | VJNRPNVIOWGIMJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |