About 2-[(2S,4R)-4-fluoropyrrolidin-2-yl]propan-2-ol;hydrochloride
2-[(2S,4R)-4-fluoropyrrolidin-2-yl]propan-2-ol;hydrochloride (PubChem CID 167724587) has the molecular formula C7H15ClFNO
and a molecular weight of 183.65 g/mol. Its IUPAC name is 2-[(2S,4R)-4-fluoropyrrolidin-2-yl]propan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 2-[(2S,4R)-4-fluoropyrrolidin-2-yl]propan-2-ol;hydrochloride |
| PubChem CID | 167724587 |
| Molecular Formula | C7H15ClFNO |
| Molecular Weight | 183.65 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 2-[(2S,4R)-4-fluoropyrrolidin-2-yl]propan-2-ol;hydrochloride |
| SMILES | CC(C)(O)[C@@H]1C[C@@H](F)CN1.Cl |
| InChI | InChI=1S/C7H14FNO.ClH/c1-7(2,10)6-3-5(8)4-9-6;/h5-6,9-10H,3-4H2,1-2H3;1H/t5-,6+;/m1./s1 |
| InChIKey | MDBDTUWOYLFFGV-IBTYICNHSA-N |
| XLogP | 0.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.65 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2S,4R)-4-fluoropyrrolidin-2-yl]propan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,4R)-4-fluoropyrrolidin-2-yl]propan-2-ol;hydrochloride?
The IUPAC name of 2-[(2S,4R)-4-fluoropyrrolidin-2-yl]propan-2-ol;hydrochloride (CID 167724587) is 2-[(2S,4R)-4-fluoropyrrolidin-2-yl]propan-2-ol;hydrochloride.
What is the SMILES notation for 2-[(2S,4R)-4-fluoropyrrolidin-2-yl]propan-2-ol;hydrochloride?
The canonical SMILES for 2-[(2S,4R)-4-fluoropyrrolidin-2-yl]propan-2-ol;hydrochloride is CC(C)(O)[C@@H]1C[C@@H](F)CN1.Cl.
What is the InChIKey of 2-[(2S,4R)-4-fluoropyrrolidin-2-yl]propan-2-ol;hydrochloride?
The InChIKey is MDBDTUWOYLFFGV-IBTYICNHSA-N. The full InChI is InChI=1S/C7H14FNO.ClH/c1-7(2,10)6-3-5(8)4-9-6;/h5-6,9-10H,3-4H2,1-2H3;1H/t5-,6+;/m1./s1.
What are the key properties of 2-[(2S,4R)-4-fluoropyrrolidin-2-yl]propan-2-ol;hydrochloride?
2-[(2S,4R)-4-fluoropyrrolidin-2-yl]propan-2-ol;hydrochloride has a molecular weight of 183.65 g/mol, XLogP of 0.88, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,4R)-4-fluoropyrrolidin-2-yl]propan-2-ol;hydrochloride is sourced from PubChem (CID 167724587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).