C18H20N6O3 — CID 167724757
3-[5-[[[5-(aminomethyl)-1H-pyrazol-3-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167724757) has the molecular formula C18H20N6O3 and a molecular weight of 368.40 g/mol. Its IUPAC name is 3-[5-[[[5-(aminomethyl)-1H-pyrazol-3-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[[[5-(aminomethyl)-1H-pyrazol-3-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167724757 |
| Molecular Formula | C18H20N6O3 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 3-[5-[[[5-(aminomethyl)-1H-pyrazol-3-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | NCc1cc(NCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)n[nH]1 |
| InChI | InChI=1S/C18H20N6O3/c19-7-12-6-15(23-22-12)20-8-10-1-2-11-9-24(18(27)13(11)5-10)14-3-4-16(25)21-17(14)26/h1-2,5-6,14H,3-4,7-9,19H2,(H2,20,22,23)(H,21,25,26) |
| InChIKey | MQHVYLFEELPXEC-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 133.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|