C14H21BFNO2 — CID 167725246
2-(2-fluoropropan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 167725246) has the molecular formula C14H21BFNO2 and a molecular weight of 265.14 g/mol. Its IUPAC name is 2-(2-fluoropropan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-(2-fluoropropan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 167725246 |
| Molecular Formula | C14H21BFNO2 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 2-(2-fluoropropan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC(C)(F)c1cc(B2OC(C)(C)C(C)(C)O2)ccn1 |
| InChI | InChI=1S/C14H21BFNO2/c1-12(2,16)11-9-10(7-8-17-11)15-18-13(3,4)14(5,6)19-15/h7-9H,1-6H3 |
| InChIKey | PMTKZASGTMHXPI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|