C22H28N4O4 — CID 167725293
3-[4-[(5-oxa-8-azaspiro[3.5]nonan-6-ylmethylamino)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167725293) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-[4-[(5-oxa-8-azaspiro[3.5]nonan-6-ylmethylamino)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[(5-oxa-8-azaspiro[3.5]nonan-6-ylmethylamino)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167725293 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 3-[4-[(5-oxa-8-azaspiro[3.5]nonan-6-ylmethylamino)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cccc(CNCC4CNCC5(CCC5)O4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H28N4O4/c27-18-6-5-17(20(28)25-18)26-12-15-4-1-3-14(19(15)21(26)29)9-23-10-16-11-24-13-22(30-16)7-2-8-22/h1,3-4,16-17,23-24H,2,5-13H2,(H,25,27,28) |
| InChIKey | PTSNZTFTCCNVPO-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|