About 6-amino-5,5-dimethyl-3,4-dihydro-2H-pyridin-3-ol;hydrobromide
6-amino-5,5-dimethyl-3,4-dihydro-2H-pyridin-3-ol;hydrobromide (PubChem CID 167725437) has the molecular formula C7H15BrN2O
and a molecular weight of 223.11 g/mol. Its IUPAC name is 6-amino-5,5-dimethyl-3,4-dihydro-2H-pyridin-3-ol;hydrobromide.
Molecular Properties
| Compound Name | 6-amino-5,5-dimethyl-3,4-dihydro-2H-pyridin-3-ol;hydrobromide |
| PubChem CID | 167725437 |
| Molecular Formula | C7H15BrN2O |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 6-amino-5,5-dimethyl-3,4-dihydro-2H-pyridin-3-ol;hydrobromide |
| SMILES | Br.CC1(C)CC(O)CN=C1N |
| InChI | InChI=1S/C7H14N2O.BrH/c1-7(2)3-5(10)4-9-6(7)8;/h5,10H,3-4H2,1-2H3,(H2,8,9);1H |
| InChIKey | VADOQQJYLRDASQ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-5,5-dimethyl-3,4-dihydro-2H-pyridin-3-ol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5,5-dimethyl-3,4-dihydro-2H-pyridin-3-ol;hydrobromide?
The IUPAC name of 6-amino-5,5-dimethyl-3,4-dihydro-2H-pyridin-3-ol;hydrobromide (CID 167725437) is 6-amino-5,5-dimethyl-3,4-dihydro-2H-pyridin-3-ol;hydrobromide.
What is the SMILES notation for 6-amino-5,5-dimethyl-3,4-dihydro-2H-pyridin-3-ol;hydrobromide?
The canonical SMILES for 6-amino-5,5-dimethyl-3,4-dihydro-2H-pyridin-3-ol;hydrobromide is Br.CC1(C)CC(O)CN=C1N.
What is the InChIKey of 6-amino-5,5-dimethyl-3,4-dihydro-2H-pyridin-3-ol;hydrobromide?
The InChIKey is VADOQQJYLRDASQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O.BrH/c1-7(2)3-5(10)4-9-6(7)8;/h5,10H,3-4H2,1-2H3,(H2,8,9);1H.
What are the key properties of 6-amino-5,5-dimethyl-3,4-dihydro-2H-pyridin-3-ol;hydrobromide?
6-amino-5,5-dimethyl-3,4-dihydro-2H-pyridin-3-ol;hydrobromide has a molecular weight of 223.11 g/mol, XLogP of 0.71, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5,5-dimethyl-3,4-dihydro-2H-pyridin-3-ol;hydrobromide is sourced from PubChem (CID 167725437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).