C18H23BClNO2 — CID 167725819
2-chloro-3-ethyl-8-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (PubChem CID 167725819) has the molecular formula C18H23BClNO2 and a molecular weight of 331.65 g/mol. Its IUPAC name is 2-chloro-3-ethyl-8-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline.
| Compound Name | 2-chloro-3-ethyl-8-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
|---|---|
| PubChem CID | 167725819 |
| Molecular Formula | C18H23BClNO2 |
| Molecular Weight | 331.65 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-chloro-3-ethyl-8-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| SMILES | CCc1cc2ccc(B3OC(C)(C)C(C)(C)O3)c(C)c2nc1Cl |
| InChI | InChI=1S/C18H23BClNO2/c1-7-12-10-13-8-9-14(11(2)15(13)21-16(12)20)19-22-17(3,4)18(5,6)23-19/h8-10H,7H2,1-6H3 |
| InChIKey | IANKYXUUCQKRBL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.65 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|