About potassium 3,4-dihydro-2H-1,4-benzoxazin-8-yl(trifluoro)boranuide
potassium 3,4-dihydro-2H-1,4-benzoxazin-8-yl(trifluoro)boranuide (PubChem CID 167725827) has the molecular formula C8H8BF3KNO
and a molecular weight of 241.06 g/mol. Its IUPAC name is potassium 3,4-dihydro-2H-1,4-benzoxazin-8-yl(trifluoro)boranuide.
Molecular Properties
| Compound Name | potassium 3,4-dihydro-2H-1,4-benzoxazin-8-yl(trifluoro)boranuide |
| PubChem CID | 167725827 |
| Molecular Formula | C8H8BF3KNO |
| Molecular Weight | 241.06 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | potassium 3,4-dihydro-2H-1,4-benzoxazin-8-yl(trifluoro)boranuide |
| SMILES | F[B-](F)(F)c1cccc2c1OCCN2.[K+] |
| InChI | InChI=1S/C8H8BF3NO.K/c10-9(11,12)6-2-1-3-7-8(6)14-5-4-13-7;/h1-3,13H,4-5H2;/q-1;+1 |
| InChIKey | OGPFDLNHXUQHHC-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.06 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium 3,4-dihydro-2H-1,4-benzoxazin-8-yl(trifluoro)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 3,4-dihydro-2H-1,4-benzoxazin-8-yl(trifluoro)boranuide?
The IUPAC name of potassium 3,4-dihydro-2H-1,4-benzoxazin-8-yl(trifluoro)boranuide (CID 167725827) is potassium 3,4-dihydro-2H-1,4-benzoxazin-8-yl(trifluoro)boranuide.
What is the SMILES notation for potassium 3,4-dihydro-2H-1,4-benzoxazin-8-yl(trifluoro)boranuide?
The canonical SMILES for potassium 3,4-dihydro-2H-1,4-benzoxazin-8-yl(trifluoro)boranuide is F[B-](F)(F)c1cccc2c1OCCN2.[K+].
What is the InChIKey of potassium 3,4-dihydro-2H-1,4-benzoxazin-8-yl(trifluoro)boranuide?
The InChIKey is OGPFDLNHXUQHHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BF3NO.K/c10-9(11,12)6-2-1-3-7-8(6)14-5-4-13-7;/h1-3,13H,4-5H2;/q-1;+1.
What are the key properties of potassium 3,4-dihydro-2H-1,4-benzoxazin-8-yl(trifluoro)boranuide?
potassium 3,4-dihydro-2H-1,4-benzoxazin-8-yl(trifluoro)boranuide has a molecular weight of 241.06 g/mol, XLogP of -1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 3,4-dihydro-2H-1,4-benzoxazin-8-yl(trifluoro)boranuide is sourced from PubChem (CID 167725827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).