About [(1R,3R)-2,2-dimethyl-3-(trifluoromethyl)cyclopropyl]-trifluoroboranuide
[(1R,3R)-2,2-dimethyl-3-(trifluoromethyl)cyclopropyl]-trifluoroboranuide (PubChem CID 167725936) has the molecular formula C6H8BF6-
and a molecular weight of 204.93 g/mol. Its IUPAC name is [(1R,3R)-2,2-dimethyl-3-(trifluoromethyl)cyclopropyl]-trifluoroboranuide.
Molecular Properties
| Compound Name | [(1R,3R)-2,2-dimethyl-3-(trifluoromethyl)cyclopropyl]-trifluoroboranuide |
| PubChem CID | 167725936 |
| Molecular Formula | C6H8BF6- |
| Molecular Weight | 204.93 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | [(1R,3R)-2,2-dimethyl-3-(trifluoromethyl)cyclopropyl]-trifluoroboranuide |
| SMILES | CC1(C)[C@H]([B-](F)(F)F)[C@H]1C(F)(F)F |
| InChI | InChI=1S/C6H8BF6/c1-5(2)3(6(8,9)10)4(5)7(11,12)13/h3-4H,1-2H3/q-1/t3-,4-/m1/s1 |
| InChIKey | MTVRZGAYDCWCIF-QWWZWVQMSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.93 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(1R,3R)-2,2-dimethyl-3-(trifluoromethyl)cyclopropyl]-trifluoroboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,3R)-2,2-dimethyl-3-(trifluoromethyl)cyclopropyl]-trifluoroboranuide?
The IUPAC name of [(1R,3R)-2,2-dimethyl-3-(trifluoromethyl)cyclopropyl]-trifluoroboranuide (CID 167725936) is [(1R,3R)-2,2-dimethyl-3-(trifluoromethyl)cyclopropyl]-trifluoroboranuide.
What is the SMILES notation for [(1R,3R)-2,2-dimethyl-3-(trifluoromethyl)cyclopropyl]-trifluoroboranuide?
The canonical SMILES for [(1R,3R)-2,2-dimethyl-3-(trifluoromethyl)cyclopropyl]-trifluoroboranuide is CC1(C)[C@H]([B-](F)(F)F)[C@H]1C(F)(F)F.
What is the InChIKey of [(1R,3R)-2,2-dimethyl-3-(trifluoromethyl)cyclopropyl]-trifluoroboranuide?
The InChIKey is MTVRZGAYDCWCIF-QWWZWVQMSA-N. The full InChI is InChI=1S/C6H8BF6/c1-5(2)3(6(8,9)10)4(5)7(11,12)13/h3-4H,1-2H3/q-1/t3-,4-/m1/s1.
What are the key properties of [(1R,3R)-2,2-dimethyl-3-(trifluoromethyl)cyclopropyl]-trifluoroboranuide?
[(1R,3R)-2,2-dimethyl-3-(trifluoromethyl)cyclopropyl]-trifluoroboranuide has a molecular weight of 204.93 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,3R)-2,2-dimethyl-3-(trifluoromethyl)cyclopropyl]-trifluoroboranuide is sourced from PubChem (CID 167725936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).