About 5-(aminomethyl)-N,N-diethylpyridin-2-amine
5-(aminomethyl)-N,N-diethylpyridin-2-amine (PubChem CID 16772652) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 5-(aminomethyl)-N,N-diethylpyridin-2-amine.
Molecular Properties
| Compound Name | 5-(aminomethyl)-N,N-diethylpyridin-2-amine |
| PubChem CID | 16772652 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 5-(aminomethyl)-N,N-diethylpyridin-2-amine |
| SMILES | CCN(CC)c1ccc(CN)cn1 |
| InChI | InChI=1S/C10H17N3/c1-3-13(4-2)10-6-5-9(7-11)8-12-10/h5-6,8H,3-4,7,11H2,1-2H3 |
| InChIKey | OAYCTPVSIFJJOX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(aminomethyl)-N,N-diethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-N,N-diethylpyridin-2-amine?
The IUPAC name of 5-(aminomethyl)-N,N-diethylpyridin-2-amine (CID 16772652) is 5-(aminomethyl)-N,N-diethylpyridin-2-amine.
What is the SMILES notation for 5-(aminomethyl)-N,N-diethylpyridin-2-amine?
The canonical SMILES for 5-(aminomethyl)-N,N-diethylpyridin-2-amine is CCN(CC)c1ccc(CN)cn1.
What is the InChIKey of 5-(aminomethyl)-N,N-diethylpyridin-2-amine?
The InChIKey is OAYCTPVSIFJJOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c1-3-13(4-2)10-6-5-9(7-11)8-12-10/h5-6,8H,3-4,7,11H2,1-2H3.
What are the key properties of 5-(aminomethyl)-N,N-diethylpyridin-2-amine?
5-(aminomethyl)-N,N-diethylpyridin-2-amine has a molecular weight of 179.27 g/mol, XLogP of 1.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-N,N-diethylpyridin-2-amine is sourced from PubChem (CID 16772652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).