C21H22BrNO2 — CID 167727172
9H-fluoren-9-ylmethyl N-[(1S,3R)-3-(bromomethyl)cyclopentyl]carbamate (PubChem CID 167727172) has the molecular formula C21H22BrNO2 and a molecular weight of 400.32 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(1S,3R)-3-(bromomethyl)cyclopentyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(1S,3R)-3-(bromomethyl)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 167727172 |
| Molecular Formula | C21H22BrNO2 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(1S,3R)-3-(bromomethyl)cyclopentyl]carbamate |
| SMILES | O=C(N[C@H]1CC[C@@H](CBr)C1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H22BrNO2/c22-12-14-9-10-15(11-14)23-21(24)25-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,14-15,20H,9-13H2,(H,23,24)/t14-,15+/m1/s1 |
| InChIKey | DPDAJGWCJJELKO-CABCVRRESA-N |
| XLogP | 5.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|