C19H24N4O5S — CID 167727199
3-[7-[[[(3S,4R)-4-amino-1,1-dioxothian-3-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167727199) has the molecular formula C19H24N4O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is 3-[7-[[[(3S,4R)-4-amino-1,1-dioxothian-3-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[[(3S,4R)-4-amino-1,1-dioxothian-3-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167727199 |
| Molecular Formula | C19H24N4O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 3-[7-[[[(3S,4R)-4-amino-1,1-dioxothian-3-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | N[C@@H]1CCS(=O)(=O)C[C@H]1NCc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C19H24N4O5S/c20-14-6-7-29(27,28)10-15(14)21-8-11-2-1-3-12-13(11)9-23(19(12)26)16-4-5-17(24)22-18(16)25/h1-3,14-16,21H,4-10,20H2,(H,22,24,25)/t14-,15-,16?/m1/s1 |
| InChIKey | DYXARUVVEMMAPH-YGFGXBMJSA-N |
| XLogP | -0.95 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|