C23H22N4O5 — CID 167727213
4-[[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167727213) has the molecular formula C23H22N4O5 and a molecular weight of 434.45 g/mol. Its IUPAC name is 4-[[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167727213 |
| Molecular Formula | C23H22N4O5 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 4-[[7-(aminomethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | NCc1ccc2c(c1)OCCN2Cc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C23H22N4O5/c24-11-13-4-5-16-18(10-13)32-9-8-26(16)12-14-2-1-3-15-20(14)23(31)27(22(15)30)17-6-7-19(28)25-21(17)29/h1-5,10,17H,6-9,11-12,24H2,(H,25,28,29) |
| InChIKey | YUODYLWETHFBIY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|