2-(6-oxo-5-oxa-2,7-diazaspiro[3.4]octan-7-yl)acetic acid

C7H10N2O4 — CID 167727227

IUPAC2-(6-oxo-5-oxa-2,7-diazaspiro[3.4]octan-7-yl)acetic acid
SMILESO=C(O)CN1CC2(CNC2)OC1=O
InChIInChI=1S/C7H10N2O4/c10-5(11)1-9-4-7(2-8-3-7)13-6(9)12/h8H,1-4H2,(H,10,11)
InChIKeyGRKGEBIMYOLCTM-UHFFFAOYSA-N
MW186.17 g/mol
LogP-1.13
Rot. Bonds2

About 2-(6-oxo-5-oxa-2,7-diazaspiro[3.4]octan-7-yl)acetic acid

2-(6-oxo-5-oxa-2,7-diazaspiro[3.4]octan-7-yl)acetic acid (PubChem CID 167727227) has the molecular formula C7H10N2O4 and a molecular weight of 186.17 g/mol. Its IUPAC name is 2-(6-oxo-5-oxa-2,7-diazaspiro[3.4]octan-7-yl)acetic acid.

Molecular Properties

Compound Name2-(6-oxo-5-oxa-2,7-diazaspiro[3.4]octan-7-yl)acetic acid
PubChem CID167727227
Molecular FormulaC7H10N2O4
Molecular Weight186.17 g/mol
Exact Mass186.06
IUPAC Name2-(6-oxo-5-oxa-2,7-diazaspiro[3.4]octan-7-yl)acetic acid
SMILESO=C(O)CN1CC2(CNC2)OC1=O
InChIInChI=1S/C7H10N2O4/c10-5(11)1-9-4-7(2-8-3-7)13-6(9)12/h8H,1-4H2,(H,10,11)
InChIKeyGRKGEBIMYOLCTM-UHFFFAOYSA-N
XLogP-1.13
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.17
LogP ≤ 5-1.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(6-oxo-5-oxa-2,7-diazaspiro[3.4]octan-7-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-oxo-5-oxa-2,7-diazaspiro[3.4]octan-7-yl)acetic acid?
The IUPAC name of 2-(6-oxo-5-oxa-2,7-diazaspiro[3.4]octan-7-yl)acetic acid (CID 167727227) is 2-(6-oxo-5-oxa-2,7-diazaspiro[3.4]octan-7-yl)acetic acid.
What is the SMILES notation for 2-(6-oxo-5-oxa-2,7-diazaspiro[3.4]octan-7-yl)acetic acid?
The canonical SMILES for 2-(6-oxo-5-oxa-2,7-diazaspiro[3.4]octan-7-yl)acetic acid is O=C(O)CN1CC2(CNC2)OC1=O.
What is the InChIKey of 2-(6-oxo-5-oxa-2,7-diazaspiro[3.4]octan-7-yl)acetic acid?
The InChIKey is GRKGEBIMYOLCTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4/c10-5(11)1-9-4-7(2-8-3-7)13-6(9)12/h8H,1-4H2,(H,10,11).
What are the key properties of 2-(6-oxo-5-oxa-2,7-diazaspiro[3.4]octan-7-yl)acetic acid?
2-(6-oxo-5-oxa-2,7-diazaspiro[3.4]octan-7-yl)acetic acid has a molecular weight of 186.17 g/mol, XLogP of -1.13, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-oxo-5-oxa-2,7-diazaspiro[3.4]octan-7-yl)acetic acid is sourced from PubChem (CID 167727227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).