C23H26N6O3 — CID 167728123
3-[3-oxo-6-[[(2-piperazin-1-yl-3-pyridinyl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167728123) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 3-[3-oxo-6-[[(2-piperazin-1-yl-3-pyridinyl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[[(2-piperazin-1-yl-3-pyridinyl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167728123 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 3-[3-oxo-6-[[(2-piperazin-1-yl-3-pyridinyl)amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CNc4cccnc4N4CCNCC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H26N6O3/c30-20-6-5-19(22(31)27-20)29-14-16-12-15(3-4-17(16)23(29)32)13-26-18-2-1-7-25-21(18)28-10-8-24-9-11-28/h1-4,7,12,19,24,26H,5-6,8-11,13-14H2,(H,27,30,31) |
| InChIKey | YDQOOYSAYHWTAH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|