About 3-cyclopentyl-1,2-oxazole-5-sulfonamide
3-cyclopentyl-1,2-oxazole-5-sulfonamide (PubChem CID 167728142) has the molecular formula C8H12N2O3S
and a molecular weight of 216.26 g/mol. Its IUPAC name is 3-cyclopentyl-1,2-oxazole-5-sulfonamide.
Molecular Properties
| Compound Name | 3-cyclopentyl-1,2-oxazole-5-sulfonamide |
| PubChem CID | 167728142 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 3-cyclopentyl-1,2-oxazole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(C2CCCC2)no1 |
| InChI | InChI=1S/C8H12N2O3S/c9-14(11,12)8-5-7(10-13-8)6-3-1-2-4-6/h5-6H,1-4H2,(H2,9,11,12) |
| InChIKey | WZQNNGBVYFNBSY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyclopentyl-1,2-oxazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-1,2-oxazole-5-sulfonamide?
The IUPAC name of 3-cyclopentyl-1,2-oxazole-5-sulfonamide (CID 167728142) is 3-cyclopentyl-1,2-oxazole-5-sulfonamide.
What is the SMILES notation for 3-cyclopentyl-1,2-oxazole-5-sulfonamide?
The canonical SMILES for 3-cyclopentyl-1,2-oxazole-5-sulfonamide is NS(=O)(=O)c1cc(C2CCCC2)no1.
What is the InChIKey of 3-cyclopentyl-1,2-oxazole-5-sulfonamide?
The InChIKey is WZQNNGBVYFNBSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3S/c9-14(11,12)8-5-7(10-13-8)6-3-1-2-4-6/h5-6H,1-4H2,(H2,9,11,12).
What are the key properties of 3-cyclopentyl-1,2-oxazole-5-sulfonamide?
3-cyclopentyl-1,2-oxazole-5-sulfonamide has a molecular weight of 216.26 g/mol, XLogP of 0.98, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-1,2-oxazole-5-sulfonamide is sourced from PubChem (CID 167728142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).