About methyl 2-fluorosulfonyl-1,3-oxazole-4-carboxylate
methyl 2-fluorosulfonyl-1,3-oxazole-4-carboxylate (PubChem CID 167728397) has the molecular formula C5H4FNO5S
and a molecular weight of 209.15 g/mol. Its IUPAC name is methyl 2-fluorosulfonyl-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-fluorosulfonyl-1,3-oxazole-4-carboxylate |
| PubChem CID | 167728397 |
| Molecular Formula | C5H4FNO5S |
| Molecular Weight | 209.15 g/mol |
| Exact Mass | 208.98 |
| IUPAC Name | methyl 2-fluorosulfonyl-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)c1coc(S(=O)(=O)F)n1 |
| InChI | InChI=1S/C5H4FNO5S/c1-11-4(8)3-2-12-5(7-3)13(6,9)10/h2H,1H3 |
| InChIKey | JOIHOQZAGIQJDD-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.15 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-fluorosulfonyl-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-fluorosulfonyl-1,3-oxazole-4-carboxylate?
The IUPAC name of methyl 2-fluorosulfonyl-1,3-oxazole-4-carboxylate (CID 167728397) is methyl 2-fluorosulfonyl-1,3-oxazole-4-carboxylate.
What is the SMILES notation for methyl 2-fluorosulfonyl-1,3-oxazole-4-carboxylate?
The canonical SMILES for methyl 2-fluorosulfonyl-1,3-oxazole-4-carboxylate is COC(=O)c1coc(S(=O)(=O)F)n1.
What is the InChIKey of methyl 2-fluorosulfonyl-1,3-oxazole-4-carboxylate?
The InChIKey is JOIHOQZAGIQJDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4FNO5S/c1-11-4(8)3-2-12-5(7-3)13(6,9)10/h2H,1H3.
What are the key properties of methyl 2-fluorosulfonyl-1,3-oxazole-4-carboxylate?
methyl 2-fluorosulfonyl-1,3-oxazole-4-carboxylate has a molecular weight of 209.15 g/mol, XLogP of 0.12, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-fluorosulfonyl-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 167728397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).