C21H23N5O5 — CID 167728596
4-[[[1-(azetidin-3-yl)-2-oxopyrrolidin-3-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167728596) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is 4-[[[1-(azetidin-3-yl)-2-oxopyrrolidin-3-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[[1-(azetidin-3-yl)-2-oxopyrrolidin-3-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167728596 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 4-[[[1-(azetidin-3-yl)-2-oxopyrrolidin-3-yl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CNC4CCN(C5CNC5)C4=O)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H23N5O5/c27-16-5-4-15(18(28)24-16)26-19(29)13-3-1-2-11(17(13)21(26)31)8-23-14-6-7-25(20(14)30)12-9-22-10-12/h1-3,12,14-15,22-23H,4-10H2,(H,24,27,28) |
| InChIKey | YRKCUIFFPLJWTN-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|