About (6-bromo-2,3-dimethylphenoxy)-trimethylsilane
(6-bromo-2,3-dimethylphenoxy)-trimethylsilane (PubChem CID 167731755) has the molecular formula C11H17BrOSi
and a molecular weight of 273.25 g/mol. Its IUPAC name is (6-bromo-2,3-dimethylphenoxy)-trimethylsilane.
Molecular Properties
| Compound Name | (6-bromo-2,3-dimethylphenoxy)-trimethylsilane |
| PubChem CID | 167731755 |
| Molecular Formula | C11H17BrOSi |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | (6-bromo-2,3-dimethylphenoxy)-trimethylsilane |
| SMILES | Cc1ccc(Br)c(O[Si](C)(C)C)c1C |
| InChI | InChI=1S/C11H17BrOSi/c1-8-6-7-10(12)11(9(8)2)13-14(3,4)5/h6-7H,1-5H3 |
| InChIKey | WJBACWDTNVWCFQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (6-bromo-2,3-dimethylphenoxy)-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-2,3-dimethylphenoxy)-trimethylsilane?
The IUPAC name of (6-bromo-2,3-dimethylphenoxy)-trimethylsilane (CID 167731755) is (6-bromo-2,3-dimethylphenoxy)-trimethylsilane.
What is the SMILES notation for (6-bromo-2,3-dimethylphenoxy)-trimethylsilane?
The canonical SMILES for (6-bromo-2,3-dimethylphenoxy)-trimethylsilane is Cc1ccc(Br)c(O[Si](C)(C)C)c1C.
What is the InChIKey of (6-bromo-2,3-dimethylphenoxy)-trimethylsilane?
The InChIKey is WJBACWDTNVWCFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17BrOSi/c1-8-6-7-10(12)11(9(8)2)13-14(3,4)5/h6-7H,1-5H3.
What are the key properties of (6-bromo-2,3-dimethylphenoxy)-trimethylsilane?
(6-bromo-2,3-dimethylphenoxy)-trimethylsilane has a molecular weight of 273.25 g/mol, XLogP of 4.28, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-2,3-dimethylphenoxy)-trimethylsilane is sourced from PubChem (CID 167731755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).