C12H13N3O4 — CID 167732541
(2,5-dioxopyrrolidin-1-yl) N-(2-pyridin-2-ylethyl)carbamate (PubChem CID 167732541) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) N-(2-pyridin-2-ylethyl)carbamate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) N-(2-pyridin-2-ylethyl)carbamate |
|---|---|
| PubChem CID | 167732541 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) N-(2-pyridin-2-ylethyl)carbamate |
| SMILES | O=C(NCCc1ccccn1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H13N3O4/c16-10-4-5-11(17)15(10)19-12(18)14-8-6-9-3-1-2-7-13-9/h1-3,7H,4-6,8H2,(H,14,18) |
| InChIKey | CANGUZATKNGVSZ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|