C8H9BClN3O2 — CID 167732764
(7-chloro-5-ethylpyrazolo[1,5-a]pyrimidin-3-yl)boronic acid (PubChem CID 167732764) has the molecular formula C8H9BClN3O2 and a molecular weight of 225.44 g/mol. Its IUPAC name is (7-chloro-5-ethylpyrazolo[1,5-a]pyrimidin-3-yl)boronic acid.
| Compound Name | (7-chloro-5-ethylpyrazolo[1,5-a]pyrimidin-3-yl)boronic acid |
|---|---|
| PubChem CID | 167732764 |
| Molecular Formula | C8H9BClN3O2 |
| Molecular Weight | 225.44 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | (7-chloro-5-ethylpyrazolo[1,5-a]pyrimidin-3-yl)boronic acid |
| SMILES | CCc1cc(Cl)n2ncc(B(O)O)c2n1 |
| InChI | InChI=1S/C8H9BClN3O2/c1-2-5-3-7(10)13-8(12-5)6(4-11-13)9(14)15/h3-4,14-15H,2H2,1H3 |
| InChIKey | IOBLQPDBJCXCQC-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.44 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|