C20H24N4O5S — CID 167732917
3-[6-[(8,8-dioxo-8λ6-thia-2,5-diazaspiro[3.5]nonan-5-yl)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167732917) has the molecular formula C20H24N4O5S and a molecular weight of 432.50 g/mol. Its IUPAC name is 3-[6-[(8,8-dioxo-8λ6-thia-2,5-diazaspiro[3.5]nonan-5-yl)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(8,8-dioxo-8λ6-thia-2,5-diazaspiro[3.5]nonan-5-yl)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167732917 |
| Molecular Formula | C20H24N4O5S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 3-[6-[(8,8-dioxo-8λ6-thia-2,5-diazaspiro[3.5]nonan-5-yl)methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN4CCS(=O)(=O)CC45CNC5)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H24N4O5S/c25-17-4-3-16(18(26)22-17)24-9-14-7-13(1-2-15(14)19(24)27)8-23-5-6-30(28,29)12-20(23)10-21-11-20/h1-2,7,16,21H,3-6,8-12H2,(H,22,25,26) |
| InChIKey | ZLXCEPCJORAURI-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|