C12H18ClNOSi — CID 167733189
(6-chloro-1,2,3,4-tetrahydroisoquinolin-7-yl)oxy-trimethylsilane (PubChem CID 167733189) has the molecular formula C12H18ClNOSi and a molecular weight of 255.82 g/mol. Its IUPAC name is (6-chloro-1,2,3,4-tetrahydroisoquinolin-7-yl)oxy-trimethylsilane.
| Compound Name | (6-chloro-1,2,3,4-tetrahydroisoquinolin-7-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 167733189 |
| Molecular Formula | C12H18ClNOSi |
| Molecular Weight | 255.82 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | (6-chloro-1,2,3,4-tetrahydroisoquinolin-7-yl)oxy-trimethylsilane |
| SMILES | C[Si](C)(C)Oc1cc2c(cc1Cl)CCNC2 |
| InChI | InChI=1S/C12H18ClNOSi/c1-16(2,3)15-12-7-10-8-14-5-4-9(10)6-11(12)13/h6-7,14H,4-5,8H2,1-3H3 |
| InChIKey | VNFSJKRFKALGNX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.82 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|