C20H24N4O4 — CID 167733853
4-[[[(1R,3R)-3-aminocyclohexyl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167733853) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 4-[[[(1R,3R)-3-aminocyclohexyl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[[(1R,3R)-3-aminocyclohexyl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167733853 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 4-[[[(1R,3R)-3-aminocyclohexyl]amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | N[C@@H]1CCC[C@@H](NCc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C20H24N4O4/c21-12-4-2-5-13(9-12)22-10-11-3-1-6-14-17(11)20(28)24(19(14)27)15-7-8-16(25)23-18(15)26/h1,3,6,12-13,15,22H,2,4-5,7-10,21H2,(H,23,25,26)/t12-,13-,15?/m1/s1 |
| InChIKey | KSVSTBHFTMJIEM-HCYNLOQUSA-N |
| XLogP | 0.45 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|