C20H23F3N4O3 — CID 167733921
3-[3-oxo-6-[[[3-(trifluoromethyl)pyrrolidin-3-yl]methylamino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167733921) has the molecular formula C20H23F3N4O3 and a molecular weight of 424.42 g/mol. Its IUPAC name is 3-[3-oxo-6-[[[3-(trifluoromethyl)pyrrolidin-3-yl]methylamino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[[[3-(trifluoromethyl)pyrrolidin-3-yl]methylamino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167733921 |
| Molecular Formula | C20H23F3N4O3 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 3-[3-oxo-6-[[[3-(trifluoromethyl)pyrrolidin-3-yl]methylamino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CNCC4(C(F)(F)F)CCNC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H23F3N4O3/c21-20(22,23)19(5-6-24-10-19)11-25-8-12-1-2-14-13(7-12)9-27(18(14)30)15-3-4-16(28)26-17(15)29/h1-2,7,15,24-25H,3-6,8-11H2,(H,26,28,29) |
| InChIKey | MZBMQMYCOKHYBU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|