C25H30N4O3 — CID 167734160
3-[5-[[(4-amino-1-phenylpentan-3-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167734160) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 3-[5-[[(4-amino-1-phenylpentan-3-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[[(4-amino-1-phenylpentan-3-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167734160 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 3-[5-[[(4-amino-1-phenylpentan-3-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(N)C(CCc1ccccc1)NCc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C25H30N4O3/c1-16(26)21(10-8-17-5-3-2-4-6-17)27-14-18-7-9-19-15-29(25(32)20(19)13-18)22-11-12-23(30)28-24(22)31/h2-7,9,13,16,21-22,27H,8,10-12,14-15,26H2,1H3,(H,28,30,31) |
| InChIKey | XJWQDYMRFMOKOZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|