C24H33N5O4 — CID 167734234
3-[4-[[[1-[4-(methylamino)butanoyl]piperidin-4-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167734234) has the molecular formula C24H33N5O4 and a molecular weight of 455.56 g/mol. Its IUPAC name is 3-[4-[[[1-[4-(methylamino)butanoyl]piperidin-4-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[[[1-[4-(methylamino)butanoyl]piperidin-4-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167734234 |
| Molecular Formula | C24H33N5O4 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 3-[4-[[[1-[4-(methylamino)butanoyl]piperidin-4-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CNCCCC(=O)N1CCC(NCc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3)CC1 |
| InChI | InChI=1S/C24H33N5O4/c1-25-11-3-6-21(31)28-12-9-18(10-13-28)26-14-16-4-2-5-17-15-29(24(33)22(16)17)19-7-8-20(30)27-23(19)32/h2,4-5,18-19,25-26H,3,6-15H2,1H3,(H,27,30,32) |
| InChIKey | NMYVRUZRUVMZCH-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|