C20H24N4O4 — CID 167734548
2-(2,6-dioxopiperidin-3-yl)-4-[[1-[(2R)-pyrrolidin-2-yl]ethylamino]methyl]isoindole-1,3-dione (PubChem CID 167734548) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[[1-[(2R)-pyrrolidin-2-yl]ethylamino]methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[1-[(2R)-pyrrolidin-2-yl]ethylamino]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167734548 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[1-[(2R)-pyrrolidin-2-yl]ethylamino]methyl]isoindole-1,3-dione |
| SMILES | CC(NCc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)[C@H]1CCCN1 |
| InChI | InChI=1S/C20H24N4O4/c1-11(14-6-3-9-21-14)22-10-12-4-2-5-13-17(12)20(28)24(19(13)27)15-7-8-16(25)23-18(15)26/h2,4-5,11,14-15,21-22H,3,6-10H2,1H3,(H,23,25,26)/t11?,14-,15?/m1/s1 |
| InChIKey | GMIWJSSYPPEPLA-XGTXGMFGSA-N |
| XLogP | 0.32 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|