C14H12BrNO5 — CID 167734905
5-bromo-2-(phenylmethoxycarbonylaminomethyl)furan-3-carboxylic acid (PubChem CID 167734905) has the molecular formula C14H12BrNO5 and a molecular weight of 354.16 g/mol. Its IUPAC name is 5-bromo-2-(phenylmethoxycarbonylaminomethyl)furan-3-carboxylic acid.
| Compound Name | 5-bromo-2-(phenylmethoxycarbonylaminomethyl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 167734905 |
| Molecular Formula | C14H12BrNO5 |
| Molecular Weight | 354.16 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 5-bromo-2-(phenylmethoxycarbonylaminomethyl)furan-3-carboxylic acid |
| SMILES | O=C(NCc1oc(Br)cc1C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C14H12BrNO5/c15-12-6-10(13(17)18)11(21-12)7-16-14(19)20-8-9-4-2-1-3-5-9/h1-6H,7-8H2,(H,16,19)(H,17,18) |
| InChIKey | BURVFNKNZMTREZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.16 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |