C10H21NO2 — CID 167735138
(3S,4R)-3,4-bis(methoxymethyl)-3,4-dimethylpyrrolidine (PubChem CID 167735138) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is (3S,4R)-3,4-bis(methoxymethyl)-3,4-dimethylpyrrolidine.
| Compound Name | (3S,4R)-3,4-bis(methoxymethyl)-3,4-dimethylpyrrolidine |
|---|---|
| PubChem CID | 167735138 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | (3S,4R)-3,4-bis(methoxymethyl)-3,4-dimethylpyrrolidine |
| SMILES | COC[C@]1(C)CNC[C@]1(C)COC |
| InChI | InChI=1S/C10H21NO2/c1-9(7-12-3)5-11-6-10(9,2)8-13-4/h11H,5-8H2,1-4H3/t9-,10+ |
| InChIKey | VGSUIOOWZIMBDH-AOOOYVTPSA-N |
| XLogP | 0.89 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |