C21H24N6O3 — CID 167735206
3-[3-oxo-4-[[2-(1H-pyrazol-4-yl)piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167735206) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 3-[3-oxo-4-[[2-(1H-pyrazol-4-yl)piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-4-[[2-(1H-pyrazol-4-yl)piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167735206 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 3-[3-oxo-4-[[2-(1H-pyrazol-4-yl)piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cccc(CN4CCNCC4c4cn[nH]c4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H24N6O3/c28-18-5-4-16(20(29)25-18)27-12-14-3-1-2-13(19(14)21(27)30)11-26-7-6-22-10-17(26)15-8-23-24-9-15/h1-3,8-9,16-17,22H,4-7,10-12H2,(H,23,24)(H,25,28,29) |
| InChIKey | ZOMMWICEVGSSBR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|