C19H21N7O3 — CID 167735416
3-[4-[[[2-(azetidin-3-yl)triazol-4-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167735416) has the molecular formula C19H21N7O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is 3-[4-[[[2-(azetidin-3-yl)triazol-4-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[[[2-(azetidin-3-yl)triazol-4-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167735416 |
| Molecular Formula | C19H21N7O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 3-[4-[[[2-(azetidin-3-yl)triazol-4-yl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cccc(CNc4cnn(C5CNC5)n4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H21N7O3/c27-16-5-4-14(18(28)23-16)25-10-12-3-1-2-11(17(12)19(25)29)6-21-15-9-22-26(24-15)13-7-20-8-13/h1-3,9,13-14,20H,4-8,10H2,(H,21,24)(H,23,27,28) |
| InChIKey | KBHXCIOXYPTXQG-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|