About 4-(3,3,3-trifluoropropanoylamino)butanoic acid
4-(3,3,3-trifluoropropanoylamino)butanoic acid (PubChem CID 16773567) has the molecular formula C7H10F3NO3
and a molecular weight of 213.15 g/mol. Its IUPAC name is 4-(3,3,3-trifluoropropanoylamino)butanoic acid.
Molecular Properties
| Compound Name | 4-(3,3,3-trifluoropropanoylamino)butanoic acid |
| PubChem CID | 16773567 |
| Molecular Formula | C7H10F3NO3 |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 4-(3,3,3-trifluoropropanoylamino)butanoic acid |
| SMILES | O=C(O)CCCNC(=O)CC(F)(F)F |
| InChI | InChI=1S/C7H10F3NO3/c8-7(9,10)4-5(12)11-3-1-2-6(13)14/h1-4H2,(H,11,12)(H,13,14) |
| InChIKey | CKEMMJIFCMQIMH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,3,3-trifluoropropanoylamino)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3,3-trifluoropropanoylamino)butanoic acid?
The IUPAC name of 4-(3,3,3-trifluoropropanoylamino)butanoic acid (CID 16773567) is 4-(3,3,3-trifluoropropanoylamino)butanoic acid.
What is the SMILES notation for 4-(3,3,3-trifluoropropanoylamino)butanoic acid?
The canonical SMILES for 4-(3,3,3-trifluoropropanoylamino)butanoic acid is O=C(O)CCCNC(=O)CC(F)(F)F.
What is the InChIKey of 4-(3,3,3-trifluoropropanoylamino)butanoic acid?
The InChIKey is CKEMMJIFCMQIMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F3NO3/c8-7(9,10)4-5(12)11-3-1-2-6(13)14/h1-4H2,(H,11,12)(H,13,14).
What are the key properties of 4-(3,3,3-trifluoropropanoylamino)butanoic acid?
4-(3,3,3-trifluoropropanoylamino)butanoic acid has a molecular weight of 213.15 g/mol, XLogP of 0.92, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3,3-trifluoropropanoylamino)butanoic acid is sourced from PubChem (CID 16773567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).