About 4-ethynyl-1,2-benzoxazol-3-amine
4-ethynyl-1,2-benzoxazol-3-amine (PubChem CID 167736135) has the molecular formula C9H6N2O
and a molecular weight of 158.16 g/mol. Its IUPAC name is 4-ethynyl-1,2-benzoxazol-3-amine.
Molecular Properties
| Compound Name | 4-ethynyl-1,2-benzoxazol-3-amine |
| PubChem CID | 167736135 |
| Molecular Formula | C9H6N2O |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 4-ethynyl-1,2-benzoxazol-3-amine |
| SMILES | C#Cc1cccc2onc(N)c12 |
| InChI | InChI=1S/C9H6N2O/c1-2-6-4-3-5-7-8(6)9(10)11-12-7/h1,3-5H,(H2,10,11) |
| InChIKey | WTZNVYOQTGPIIB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynyl-1,2-benzoxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynyl-1,2-benzoxazol-3-amine?
The IUPAC name of 4-ethynyl-1,2-benzoxazol-3-amine (CID 167736135) is 4-ethynyl-1,2-benzoxazol-3-amine.
What is the SMILES notation for 4-ethynyl-1,2-benzoxazol-3-amine?
The canonical SMILES for 4-ethynyl-1,2-benzoxazol-3-amine is C#Cc1cccc2onc(N)c12.
What is the InChIKey of 4-ethynyl-1,2-benzoxazol-3-amine?
The InChIKey is WTZNVYOQTGPIIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O/c1-2-6-4-3-5-7-8(6)9(10)11-12-7/h1,3-5H,(H2,10,11).
What are the key properties of 4-ethynyl-1,2-benzoxazol-3-amine?
4-ethynyl-1,2-benzoxazol-3-amine has a molecular weight of 158.16 g/mol, XLogP of 1.39, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynyl-1,2-benzoxazol-3-amine is sourced from PubChem (CID 167736135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).