About 4-(2,2-difluoro-1-methoxyethyl)piperidine;hydrochloride
4-(2,2-difluoro-1-methoxyethyl)piperidine;hydrochloride (PubChem CID 167736904) has the molecular formula C8H16ClF2NO
and a molecular weight of 215.67 g/mol. Its IUPAC name is 4-(2,2-difluoro-1-methoxyethyl)piperidine;hydrochloride.
Molecular Properties
| Compound Name | 4-(2,2-difluoro-1-methoxyethyl)piperidine;hydrochloride |
| PubChem CID | 167736904 |
| Molecular Formula | C8H16ClF2NO |
| Molecular Weight | 215.67 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 4-(2,2-difluoro-1-methoxyethyl)piperidine;hydrochloride |
| SMILES | COC(C(F)F)C1CCNCC1.Cl |
| InChI | InChI=1S/C8H15F2NO.ClH/c1-12-7(8(9)10)6-2-4-11-5-3-6;/h6-8,11H,2-5H2,1H3;1H |
| InChIKey | BSQKDQOWXRUTNA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.67 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2,2-difluoro-1-methoxyethyl)piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-difluoro-1-methoxyethyl)piperidine;hydrochloride?
The IUPAC name of 4-(2,2-difluoro-1-methoxyethyl)piperidine;hydrochloride (CID 167736904) is 4-(2,2-difluoro-1-methoxyethyl)piperidine;hydrochloride.
What is the SMILES notation for 4-(2,2-difluoro-1-methoxyethyl)piperidine;hydrochloride?
The canonical SMILES for 4-(2,2-difluoro-1-methoxyethyl)piperidine;hydrochloride is COC(C(F)F)C1CCNCC1.Cl.
What is the InChIKey of 4-(2,2-difluoro-1-methoxyethyl)piperidine;hydrochloride?
The InChIKey is BSQKDQOWXRUTNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2NO.ClH/c1-12-7(8(9)10)6-2-4-11-5-3-6;/h6-8,11H,2-5H2,1H3;1H.
What are the key properties of 4-(2,2-difluoro-1-methoxyethyl)piperidine;hydrochloride?
4-(2,2-difluoro-1-methoxyethyl)piperidine;hydrochloride has a molecular weight of 215.67 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-difluoro-1-methoxyethyl)piperidine;hydrochloride is sourced from PubChem (CID 167736904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).