C11H15ClN2O — CID 16773722
2-amino-4-chloro-N,N-diethylbenzamide (PubChem CID 16773722) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is 2-amino-4-chloro-N,N-diethylbenzamide.
| Compound Name | 2-amino-4-chloro-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 16773722 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-amino-4-chloro-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C11H15ClN2O/c1-3-14(4-2)11(15)9-6-5-8(12)7-10(9)13/h5-7H,3-4,13H2,1-2H3 |
| InChIKey | UOWXMPFGGZIDTH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|