C25H31F3N4O3 — CID 167737435
3-[3-oxo-6-[[2-piperidin-4-yl-5-(trifluoromethyl)piperidin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167737435) has the molecular formula C25H31F3N4O3 and a molecular weight of 492.54 g/mol. Its IUPAC name is 3-[3-oxo-6-[[2-piperidin-4-yl-5-(trifluoromethyl)piperidin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[[2-piperidin-4-yl-5-(trifluoromethyl)piperidin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167737435 |
| Molecular Formula | C25H31F3N4O3 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 3-[3-oxo-6-[[2-piperidin-4-yl-5-(trifluoromethyl)piperidin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN4CC(C(F)(F)F)CCC4C4CCNCC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H31F3N4O3/c26-25(27,28)18-2-4-20(16-7-9-29-10-8-16)31(14-18)12-15-1-3-19-17(11-15)13-32(24(19)35)21-5-6-22(33)30-23(21)34/h1,3,11,16,18,20-21,29H,2,4-10,12-14H2,(H,30,33,34) |
| InChIKey | KMOXOGOFXNKZSV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|