About 4-(2-amino-1,3-thiazol-4-yl)-N'-hydroxybenzenecarboximidamide
4-(2-amino-1,3-thiazol-4-yl)-N'-hydroxybenzenecarboximidamide (PubChem CID 16773762) has the molecular formula C10H10N4OS
and a molecular weight of 234.28 g/mol. Its IUPAC name is 4-(2-amino-1,3-thiazol-4-yl)-N'-hydroxybenzenecarboximidamide.
Molecular Properties
| Compound Name | 4-(2-amino-1,3-thiazol-4-yl)-N'-hydroxybenzenecarboximidamide |
| PubChem CID | 16773762 |
| Molecular Formula | C10H10N4OS |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 4-(2-amino-1,3-thiazol-4-yl)-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(-c2csc(N)n2)cc1 |
| InChI | InChI=1S/C10H10N4OS/c11-9(14-15)7-3-1-6(2-4-7)8-5-16-10(12)13-8/h1-5,15H,(H2,11,14)(H2,12,13) |
| InChIKey | RYEKNFUNLUKXBZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-amino-1,3-thiazol-4-yl)-N'-hydroxybenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-1,3-thiazol-4-yl)-N'-hydroxybenzenecarboximidamide?
The IUPAC name of 4-(2-amino-1,3-thiazol-4-yl)-N'-hydroxybenzenecarboximidamide (CID 16773762) is 4-(2-amino-1,3-thiazol-4-yl)-N'-hydroxybenzenecarboximidamide.
What is the SMILES notation for 4-(2-amino-1,3-thiazol-4-yl)-N'-hydroxybenzenecarboximidamide?
The canonical SMILES for 4-(2-amino-1,3-thiazol-4-yl)-N'-hydroxybenzenecarboximidamide is N/C(=N\O)c1ccc(-c2csc(N)n2)cc1.
What is the InChIKey of 4-(2-amino-1,3-thiazol-4-yl)-N'-hydroxybenzenecarboximidamide?
The InChIKey is RYEKNFUNLUKXBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4OS/c11-9(14-15)7-3-1-6(2-4-7)8-5-16-10(12)13-8/h1-5,15H,(H2,11,14)(H2,12,13).
What are the key properties of 4-(2-amino-1,3-thiazol-4-yl)-N'-hydroxybenzenecarboximidamide?
4-(2-amino-1,3-thiazol-4-yl)-N'-hydroxybenzenecarboximidamide has a molecular weight of 234.28 g/mol, XLogP of 1.49, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-1,3-thiazol-4-yl)-N'-hydroxybenzenecarboximidamide is sourced from PubChem (CID 16773762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).