C20H22N8O4 — CID 167737689
2-(2,6-dioxopiperidin-3-yl)-4-[[[4-(2H-tetrazol-5-yl)piperidin-4-yl]amino]methyl]isoindole-1,3-dione (PubChem CID 167737689) has the molecular formula C20H22N8O4 and a molecular weight of 438.45 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[[[4-(2H-tetrazol-5-yl)piperidin-4-yl]amino]methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[[4-(2H-tetrazol-5-yl)piperidin-4-yl]amino]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167737689 |
| Molecular Formula | C20H22N8O4 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[[4-(2H-tetrazol-5-yl)piperidin-4-yl]amino]methyl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CNC4(c5nn[nH]n5)CCNCC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H22N8O4/c29-14-5-4-13(16(30)23-14)28-17(31)12-3-1-2-11(15(12)18(28)32)10-22-20(6-8-21-9-7-20)19-24-26-27-25-19/h1-3,13,21-22H,4-10H2,(H,23,29,30)(H,24,25,26,27) |
| InChIKey | NHZQTYANAUVSCA-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 162.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|