C26H30N4O3 — CID 167739138
3-[6-[[2-methyl-6-(methylaminomethyl)-3,4-dihydro-2H-quinolin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167739138) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is 3-[6-[[2-methyl-6-(methylaminomethyl)-3,4-dihydro-2H-quinolin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[2-methyl-6-(methylaminomethyl)-3,4-dihydro-2H-quinolin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167739138 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 3-[6-[[2-methyl-6-(methylaminomethyl)-3,4-dihydro-2H-quinolin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CNCc1ccc2c(c1)CCC(C)N2Cc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C26H30N4O3/c1-16-3-6-19-11-17(13-27-2)5-8-22(19)29(16)14-18-4-7-21-20(12-18)15-30(26(21)33)23-9-10-24(31)28-25(23)32/h4-5,7-8,11-12,16,23,27H,3,6,9-10,13-15H2,1-2H3,(H,28,31,32) |
| InChIKey | YOPBTINNHMZYIW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|